C25H38O2 — CID 147603235
(1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 147603235) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 147603235 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)[C@@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C)OCc1ccccc1 |
| InChI | InChI=1S/C25H38O2/c1-18(2)24(27-17-20-9-6-5-7-10-20)15-12-19(3)21-13-14-22-23(26)11-8-16-25(21,22)4/h5-7,9-10,12,15,18-19,21-24,26H,8,11,13-14,16-17H2,1-4H3/b15-12+/t19-,21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | GAOBRUSYIHWLNN-SHWXZVSQSA-N |
| XLogP | 6.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|