C9H10O5 — CID 147604988
3-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-2-oxopropanoic acid (PubChem CID 147604988) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 3-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-2-oxopropanoic acid.
| Compound Name | 3-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 147604988 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-2-oxopropanoic acid |
| SMILES | C[C@H]1C=CC(=O)O[C@H]1CC(=O)C(=O)O |
| InChI | InChI=1S/C9H10O5/c1-5-2-3-8(11)14-7(5)4-6(10)9(12)13/h2-3,5,7H,4H2,1H3,(H,12,13)/t5-,7-/m0/s1 |
| InChIKey | GAWOAEOOETULTK-FSPLSTOPSA-N |
| XLogP | 0.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|