C13H9Cl3N2O2 — CID 1476068
(2,6-dimethylpyrimidin-4-yl) 2,4,6-trichlorobenzoate (PubChem CID 1476068) has the molecular formula C13H9Cl3N2O2 and a molecular weight of 331.59 g/mol. Its IUPAC name is (2,6-dimethylpyrimidin-4-yl) 2,4,6-trichlorobenzoate.
| Compound Name | (2,6-dimethylpyrimidin-4-yl) 2,4,6-trichlorobenzoate |
|---|---|
| PubChem CID | 1476068 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | (2,6-dimethylpyrimidin-4-yl) 2,4,6-trichlorobenzoate |
| SMILES | Cc1cc(OC(=O)c2c(Cl)cc(Cl)cc2Cl)nc(C)n1 |
| InChI | InChI=1S/C13H9Cl3N2O2/c1-6-3-11(18-7(2)17-6)20-13(19)12-9(15)4-8(14)5-10(12)16/h3-5H,1-2H3 |
| InChIKey | HTENBYCZJPUMAQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |