C26H24F3NO2 — CID 147608106
2-[1-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]ethylamino]acetic acid (PubChem CID 147608106) has the molecular formula C26H24F3NO2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-[1-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]ethylamino]acetic acid.
| Compound Name | 2-[1-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]ethylamino]acetic acid |
|---|---|
| PubChem CID | 147608106 |
| Molecular Formula | C26H24F3NO2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[1-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]ethylamino]acetic acid |
| SMILES | Cc1c(/C=C/c2cc(C(C)NCC(=O)O)ccc2C(F)(F)F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C26H24F3NO2/c1-17-19(9-6-10-23(17)20-7-4-3-5-8-20)11-12-22-15-21(18(2)30-16-25(31)32)13-14-24(22)26(27,28)29/h3-15,18,30H,16H2,1-2H3,(H,31,32)/b12-11+ |
| InChIKey | GBLQHBIRTKNZSR-VAWYXSNFSA-N |
| XLogP | 6.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|