C24H29N5O4 — CID 147613534
methyl N-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 147613534) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is methyl N-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | methyl N-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 147613534 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | methyl N-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@H](c3ccccc3)CN2)cc1 |
| InChI | InChI=1S/C24H29N5O4/c1-15(28-23(31)20-12-19(14-26-20)17-6-4-3-5-7-17)22(30)27-13-16-8-10-18(11-9-16)21(25)29-24(32)33-2/h3-11,15,19-20,26H,12-14H2,1-2H3,(H,27,30)(H,28,31)(H2,25,29,32)/t15-,19-,20+/m0/s1 |
| InChIKey | GCLRSTDBTWHZFI-RYGJVYDSSA-N |
| XLogP | 1.63 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|