C21H38N4O4S — CID 147614747
2-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonylcarbamoylamino]-N,2-dimethylpropanamide (PubChem CID 147614747) has the molecular formula C21H38N4O4S and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonylcarbamoylamino]-N,2-dimethylpropanamide.
| Compound Name | 2-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonylcarbamoylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 147614747 |
| Molecular Formula | C21H38N4O4S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonylcarbamoylamino]-N,2-dimethylpropanamide |
| SMILES | CCN1C(=O)CC(SCCCCCCCCCNC(=O)NC(C)(C)C(=O)NC)C1=O |
| InChI | InChI=1S/C21H38N4O4S/c1-5-25-17(26)15-16(18(25)27)30-14-12-10-8-6-7-9-11-13-23-20(29)24-21(2,3)19(28)22-4/h16H,5-15H2,1-4H3,(H,22,28)(H2,23,24,29) |
| InChIKey | GCRQRHNAMZGTGO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|