About 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine
4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine (PubChem CID 147618395) has the molecular formula C12H12NO2PS
and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine.
Molecular Properties
| Compound Name | 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine |
| PubChem CID | 147618395 |
| Molecular Formula | C12H12NO2PS |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine |
| SMILES | CCP1(=O)c2ccccc2Sc2occ(N)c21 |
| InChI | InChI=1S/C12H12NO2PS/c1-2-16(14)9-5-3-4-6-10(9)17-12-11(16)8(13)7-15-12/h3-7H,2,13H2,1H3 |
| InChIKey | GDJMFQHUZSAPGV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine?
The IUPAC name of 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine (CID 147618395) is 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine.
What is the SMILES notation for 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine?
The canonical SMILES for 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine is CCP1(=O)c2ccccc2Sc2occ(N)c21.
What is the InChIKey of 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine?
The InChIKey is GDJMFQHUZSAPGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NO2PS/c1-2-16(14)9-5-3-4-6-10(9)17-12-11(16)8(13)7-15-12/h3-7H,2,13H2,1H3.
What are the key properties of 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine?
4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine has a molecular weight of 265.27 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-oxo-[1,4]benzothiaphosphinino[2,3-b]furan-3-amine is sourced from PubChem (CID 147618395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).