C23H31N3O8 — CID 147619026
(2,5-dioxopyrrolidin-1-yl) (2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoate (PubChem CID 147619026) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoate |
|---|---|
| PubChem CID | 147619026 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)C[C@@H](C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C23H31N3O8/c1-14(2)22(16(27)13-15(3)23(33)34-26-20(31)10-11-21(26)32)24-17(28)7-5-4-6-12-25-18(29)8-9-19(25)30/h8-9,14-15,22H,4-7,10-13H2,1-3H3,(H,24,28)/t15-,22+/m1/s1 |
| InChIKey | GDMNVRXAIXFZIG-QRQCRPRQSA-N |
| XLogP | 0.82 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|