C13H15N3O2 — CID 147619294
(4-cyanophenyl) (Z)-2,5-diaminohex-3-enoate (PubChem CID 147619294) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is (4-cyanophenyl) (Z)-2,5-diaminohex-3-enoate.
| Compound Name | (4-cyanophenyl) (Z)-2,5-diaminohex-3-enoate |
|---|---|
| PubChem CID | 147619294 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (4-cyanophenyl) (Z)-2,5-diaminohex-3-enoate |
| SMILES | CC(N)/C=C\C(N)C(=O)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H15N3O2/c1-9(15)2-7-12(16)13(17)18-11-5-3-10(8-14)4-6-11/h2-7,9,12H,15-16H2,1H3/b7-2- |
| InChIKey | GDNZFSNVRJAJJK-UQCOIBPSSA-N |
| XLogP | 0.69 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|