C7H14N2 — CID 147619545
N,5-dimethyl-1,2,3,4-tetrahydropyridin-6-amine (PubChem CID 147619545) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N,5-dimethyl-1,2,3,4-tetrahydropyridin-6-amine.
| Compound Name | N,5-dimethyl-1,2,3,4-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 147619545 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N,5-dimethyl-1,2,3,4-tetrahydropyridin-6-amine |
| SMILES | CNC1=C(C)CCCN1 |
| InChI | InChI=1S/C7H14N2/c1-6-4-3-5-9-7(6)8-2/h8-9H,3-5H2,1-2H3 |
| InChIKey | GDPFEBFZGAOZRI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |