C24H23ClN4O2S — CID 147620509
N-(5-chloro-2-pyridinyl)-3-[2-[4-(2-methylpyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 147620509) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[2-[4-(2-methylpyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[2-[4-(2-methylpyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 147620509 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[2-[4-(2-methylpyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccsc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCC1C |
| InChI | InChI=1S/C24H23ClN4O2S/c1-15-3-2-11-29(15)23(26)17-6-4-16(5-7-17)20(30)13-18-10-12-32-22(18)24(31)28-21-9-8-19(25)14-27-21/h4-10,12,14-15,26H,2-3,11,13H2,1H3,(H,27,28,31)/b26-23- |
| InChIKey | GDTUBTRQLLTXSA-RWEWTDSWSA-N |
| XLogP | 5.28 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|