About 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine
2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine (PubChem CID 14762115) has the molecular formula C30H35N3O2
and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine |
| PubChem CID | 14762115 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOC(COc1ccccc1)Cn1nc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C30H35N3O2/c1-3-32(4-2)20-21-34-28(24-35-27-18-12-7-13-19-27)23-33-30(26-16-10-6-11-17-26)22-29(31-33)25-14-8-5-9-15-25/h5-19,22,28H,3-4,20-21,23-24H2,1-2H3 |
| InChIKey | LUAFNYWOMVNZHU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine?
The IUPAC name of 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine (CID 14762115) is 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine.
What is the SMILES notation for 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine?
The canonical SMILES for 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine is CCN(CC)CCOC(COc1ccccc1)Cn1nc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine?
The InChIKey is LUAFNYWOMVNZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35N3O2/c1-3-32(4-2)20-21-34-28(24-35-27-18-12-7-13-19-27)23-33-30(26-16-10-6-11-17-26)22-29(31-33)25-14-8-5-9-15-25/h5-19,22,28H,3-4,20-21,23-24H2,1-2H3.
What are the key properties of 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine?
2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine has a molecular weight of 469.63 g/mol, XLogP of 6.02, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,5-diphenylpyrazol-1-yl)-3-phenoxypropan-2-yl]oxy-N,N-diethylethanamine is sourced from PubChem (CID 14762115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).