C20H22N2O4 — CID 14762483
1,4-dibenzyl-3,6-dimethoxypiperazine-2,5-dione (PubChem CID 14762483) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1,4-dibenzyl-3,6-dimethoxypiperazine-2,5-dione.
| Compound Name | 1,4-dibenzyl-3,6-dimethoxypiperazine-2,5-dione |
|---|---|
| PubChem CID | 14762483 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1,4-dibenzyl-3,6-dimethoxypiperazine-2,5-dione |
| SMILES | COC1C(=O)N(Cc2ccccc2)C(OC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-19-17(23)22(14-16-11-7-4-8-12-16)20(26-2)18(24)21(19)13-15-9-5-3-6-10-15/h3-12,19-20H,13-14H2,1-2H3 |
| InChIKey | VTZXWMFVBXSSSE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |