C18H15F3N2O — CID 147625011
N,N-dimethyl-2-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzamide (PubChem CID 147625011) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzamide.
| Compound Name | N,N-dimethyl-2-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzamide |
|---|---|
| PubChem CID | 147625011 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N,N-dimethyl-2-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccccc1-c1cc(C(F)(F)F)cc2c1C=NC2 |
| InChI | InChI=1S/C18H15F3N2O/c1-23(2)17(24)14-6-4-3-5-13(14)15-8-12(18(19,20)21)7-11-9-22-10-16(11)15/h3-8,10H,9H2,1-2H3 |
| InChIKey | GEPJWZRUAIROFU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |