C24H18Cl3N3 — CID 14762542
1-N,3-N,5-N-tris(4-chlorophenyl)benzene-1,3,5-triamine (PubChem CID 14762542) has the molecular formula C24H18Cl3N3 and a molecular weight of 454.79 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(4-chlorophenyl)benzene-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(4-chlorophenyl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 14762542 |
| Molecular Formula | C24H18Cl3N3 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 1-N,3-N,5-N-tris(4-chlorophenyl)benzene-1,3,5-triamine |
| SMILES | Clc1ccc(Nc2cc(Nc3ccc(Cl)cc3)cc(Nc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C24H18Cl3N3/c25-16-1-7-19(8-2-16)28-22-13-23(29-20-9-3-17(26)4-10-20)15-24(14-22)30-21-11-5-18(27)6-12-21/h1-15,28-30H |
| InChIKey | XASKKFXVYNAGJL-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |