About 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one
1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one (PubChem CID 147627387) has the molecular formula C11H20O2S2+2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one.
Molecular Properties
| Compound Name | 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one |
| PubChem CID | 147627387 |
| Molecular Formula | C11H20O2S2+2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one |
| SMILES | C[S+]1CC(=O)CCC1C1OCCC[S+]1C |
| InChI | InChI=1S/C11H20O2S2/c1-14-7-3-6-13-11(14)10-5-4-9(12)8-15(10)2/h10-11H,3-8H2,1-2H3/q+2 |
| InChIKey | GFAXYAWULZLELN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one?
The IUPAC name of 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one (CID 147627387) is 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one.
What is the SMILES notation for 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one?
The canonical SMILES for 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one is C[S+]1CC(=O)CCC1C1OCCC[S+]1C.
What is the InChIKey of 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one?
The InChIKey is GFAXYAWULZLELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S2/c1-14-7-3-6-13-11(14)10-5-4-9(12)8-15(10)2/h10-11H,3-8H2,1-2H3/q+2.
What are the key properties of 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one?
1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one has a molecular weight of 248.41 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-(3-methyl-1,3-oxathian-3-ium-2-yl)thian-1-ium-3-one is sourced from PubChem (CID 147627387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).