About CID 147627416
CID 147627416 (PubChem CID 147627416) has the molecular formula C12H7AlBrN
and a molecular weight of 272.08 g/mol.
Molecular Properties
| Compound Name | CID 147627416 |
| PubChem CID | 147627416 |
| Molecular Formula | C12H7AlBrN |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | — |
| SMILES | [Al]n1c2ccccc2c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H7BrN.Al/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;/h1-7H;/q-1;+1 |
| InChIKey | JJIXKYNAWBUJJH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 147627416 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147627416?
The IUPAC name of CID 147627416 (CID 147627416) is not available.
What is the SMILES notation for CID 147627416?
The canonical SMILES for CID 147627416 is [Al]n1c2ccccc2c2cc(Br)ccc21.
What is the InChIKey of CID 147627416?
The InChIKey is JJIXKYNAWBUJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrN.Al/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;/h1-7H;/q-1;+1.
What are the key properties of CID 147627416?
CID 147627416 has a molecular weight of 272.08 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147627416 is sourced from PubChem (CID 147627416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).