C20H22FN5O — CID 147628685
N-ethyl-2-[4-[2-[(1-ethylpyrazol-4-yl)methyl]pyrimidin-5-yl]-2-fluorophenyl]acetamide (PubChem CID 147628685) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is N-ethyl-2-[4-[2-[(1-ethylpyrazol-4-yl)methyl]pyrimidin-5-yl]-2-fluorophenyl]acetamide.
| Compound Name | N-ethyl-2-[4-[2-[(1-ethylpyrazol-4-yl)methyl]pyrimidin-5-yl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 147628685 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-ethyl-2-[4-[2-[(1-ethylpyrazol-4-yl)methyl]pyrimidin-5-yl]-2-fluorophenyl]acetamide |
| SMILES | CCNC(=O)Cc1ccc(-c2cnc(Cc3cnn(CC)c3)nc2)cc1F |
| InChI | InChI=1S/C20H22FN5O/c1-3-22-20(27)9-16-6-5-15(8-18(16)21)17-11-23-19(24-12-17)7-14-10-25-26(4-2)13-14/h5-6,8,10-13H,3-4,7,9H2,1-2H3,(H,22,27) |
| InChIKey | GFGZROJYWQCMRD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |