C10H16N2O4 — CID 147629433
[(7R,7aR)-4-amino-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate (PubChem CID 147629433) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is [(7R,7aR)-4-amino-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate.
| Compound Name | [(7R,7aR)-4-amino-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate |
|---|---|
| PubChem CID | 147629433 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [(7R,7aR)-4-amino-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CN=C(N)C2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C10H16N2O4/c1-5(13)14-6-4-12-9(11)8-7(6)15-10(2,3)16-8/h6-8H,4H2,1-3H3,(H2,11,12)/t6-,7-,8?/m1/s1 |
| InChIKey | GFKNBUFPAMYJKV-GCJDJSOWSA-N |
| XLogP | -0.19 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |