C31H36N3+ — CID 147630734
12-tert-butyl-5,5,7,7,19,21-hexamethyl-20-methylidene-11,13-diaza-1-azoniaheptacyclo[12.7.2.02,10.04,8.011,22.018,23.019,21]tricosa-1(22),2(10),3,8,12,14,16,18(23)-octaene (PubChem CID 147630734) has the molecular formula C31H36N3+ and a molecular weight of 450.65 g/mol. Its IUPAC name is 12-tert-butyl-5,5,7,7,19,21-hexamethyl-20-methylidene-11,13-diaza-1-azoniaheptacyclo[12.7.2.02,10.04,8.011,22.018,23.019,21]tricosa-1(22),2(10),3,8,12,14,16,18(23)-octaene.
| Compound Name | 12-tert-butyl-5,5,7,7,19,21-hexamethyl-20-methylidene-11,13-diaza-1-azoniaheptacyclo[12.7.2.02,10.04,8.011,22.018,23.019,21]tricosa-1(22),2(10),3,8,12,14,16,18(23)-octaene |
|---|---|
| PubChem CID | 147630734 |
| Molecular Formula | C31H36N3+ |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 12-tert-butyl-5,5,7,7,19,21-hexamethyl-20-methylidene-11,13-diaza-1-azoniaheptacyclo[12.7.2.02,10.04,8.011,22.018,23.019,21]tricosa-1(22),2(10),3,8,12,14,16,18(23)-octaene |
| SMILES | C=C1C2(C)c3cccc4nc(C(C)(C)C)n5c6cc7c(cc6[n+](c5c34)C12C)C(C)(C)CC7(C)C |
| InChI | InChI=1S/C31H36N3/c1-17-30(9)18-12-11-13-21-24(18)25-33(26(32-21)27(2,3)4)22-14-19-20(29(7,8)16-28(19,5)6)15-23(22)34(25)31(17,30)10/h11-15H,1,16H2,2-10H3/q+1 |
| InChIKey | VFGLEYQJQIAZBA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|