C18H27ClN5O8P — CID 147635894
[(2S)-2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid (PubChem CID 147635894) has the molecular formula C18H27ClN5O8P and a molecular weight of 507.87 g/mol. Its IUPAC name is [(2S)-2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid.
| Compound Name | [(2S)-2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 147635894 |
| Molecular Formula | C18H27ClN5O8P |
| Molecular Weight | 507.87 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(2S)-2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonic acid |
| SMILES | C[C@](CO)(OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C18H27ClN5O8P/c1-18(8-25,33(28,29)30)31-7-11-14(26)15(27)17(32-11)24-16-13(22-23-24)10(6-12(19)21-16)20-9-4-2-3-5-9/h6,9,11,14-15,17,25-27H,2-5,7-8H2,1H3,(H,20,21)(H2,28,29,30)/t11-,14-,15-,17-,18+/m1/s1 |
| InChIKey | GGQBVWCRZWHDHX-BBVCAZISSA-N |
| XLogP | 0.36 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.87 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|