C9H12BrN3 — CID 147637662
3-bromo-5-methanimidoyl-4-N-methylcyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 147637662) has the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. Its IUPAC name is 3-bromo-5-methanimidoyl-4-N-methylcyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | 3-bromo-5-methanimidoyl-4-N-methylcyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 147637662 |
| Molecular Formula | C9H12BrN3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 3-bromo-5-methanimidoyl-4-N-methylcyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | [H]/N=C/C1=CCC(N)=CC(Br)=C1NC |
| InChI | InChI=1S/C9H12BrN3/c1-13-9-6(5-11)2-3-7(12)4-8(9)10/h2,4-5,11,13H,3,12H2,1H3/b11-5+ |
| InChIKey | GGZAIBZOJVQJHA-VZUCSPMQSA-N |
| XLogP | 1.63 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|