C32H36IN4O6- — CID 147637700
[(19R)-10-ethyl-19-hydroxy-19-methyliodanuidyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate (PubChem CID 147637700) has the molecular formula C32H36IN4O6- and a molecular weight of 699.57 g/mol. Its IUPAC name is [(19R)-10-ethyl-19-hydroxy-19-methyliodanuidyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate.
| Compound Name | [(19R)-10-ethyl-19-hydroxy-19-methyliodanuidyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 147637700 |
| Molecular Formula | C32H36IN4O6- |
| Molecular Weight | 699.57 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | [(19R)-10-ethyl-19-hydroxy-19-methyliodanuidyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)N4CCC(N5CCCCC5)CC4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)[I-]C |
| InChI | InChI=1S/C32H36IN4O6/c1-3-21-22-15-20(43-31(40)36-13-9-19(10-14-36)35-11-5-4-6-12-35)7-8-26(22)34-28-23(21)17-37-27(28)16-25-24(29(37)38)18-42-30(39)32(25,41)33-2/h7-8,15-16,19,41H,3-6,9-14,17-18H2,1-2H3/q-1/t32-/m0/s1 |
| InChIKey | UZEVTTUGFSCZRO-YTTGMZPUSA-N |
| XLogP | 0.36 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.57 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|