C30H36ClN3O3S — CID 147637893
(2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-8-(dimethylamino)-5-oxo-1-phenyloct-6-en-2-yl]-4-oxohexanamide (PubChem CID 147637893) has the molecular formula C30H36ClN3O3S and a molecular weight of 554.16 g/mol. Its IUPAC name is (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-8-(dimethylamino)-5-oxo-1-phenyloct-6-en-2-yl]-4-oxohexanamide.
| Compound Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-8-(dimethylamino)-5-oxo-1-phenyloct-6-en-2-yl]-4-oxohexanamide |
|---|---|
| PubChem CID | 147637893 |
| Molecular Formula | C30H36ClN3O3S |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-8-(dimethylamino)-5-oxo-1-phenyloct-6-en-2-yl]-4-oxohexanamide |
| SMILES | CCC(=O)C[C@@H](Cc1nc2ccc(Cl)cc2s1)C(=O)N[C@H](CCC(=O)/C=C/CN(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C30H36ClN3O3S/c1-4-25(35)18-22(19-29-33-27-15-12-23(31)20-28(27)38-29)30(37)32-24(17-21-9-6-5-7-10-21)13-14-26(36)11-8-16-34(2)3/h5-12,15,20,22,24H,4,13-14,16-19H2,1-3H3,(H,32,37)/b11-8+/t22-,24+/m0/s1 |
| InChIKey | GHAGARLVHYMOAZ-KUJVOSRNSA-N |
| XLogP | 5.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|