C15H23F2N — CID 147638219
(E,2E)-2-but-3-en-2-ylidene-N-(1,1-difluoropropan-2-yl)-4,5-dimethylhex-3-en-1-imine (PubChem CID 147638219) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is (E,2E)-2-but-3-en-2-ylidene-N-(1,1-difluoropropan-2-yl)-4,5-dimethylhex-3-en-1-imine.
| Compound Name | (E,2E)-2-but-3-en-2-ylidene-N-(1,1-difluoropropan-2-yl)-4,5-dimethylhex-3-en-1-imine |
|---|---|
| PubChem CID | 147638219 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (E,2E)-2-but-3-en-2-ylidene-N-(1,1-difluoropropan-2-yl)-4,5-dimethylhex-3-en-1-imine |
| SMILES | C=C/C(C)=C(/C=N/C(C)C(F)F)\C=C(/C)C(C)C |
| InChI | InChI=1S/C15H23F2N/c1-7-11(4)14(8-12(5)10(2)3)9-18-13(6)15(16)17/h7-10,13,15H,1H2,2-6H3/b12-8+,14-11+,18-9+ |
| InChIKey | GHBZVVLSKLGFDP-YOJJZURDSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|