About N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine
N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine (PubChem CID 14764219) has the molecular formula C11H12F3NO
and a molecular weight of 231.22 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine |
| PubChem CID | 14764219 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine |
| SMILES | C=CCC(NO)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO/c1-2-8-10(15-16,11(12,13)14)9-6-4-3-5-7-9/h2-7,15-16H,1,8H2 |
| InChIKey | XWHYNMPHCNJWHN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine?
The IUPAC name of N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine (CID 14764219) is N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine.
What is the SMILES notation for N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine?
The canonical SMILES for N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine is C=CCC(NO)(c1ccccc1)C(F)(F)F.
What is the InChIKey of N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine?
The InChIKey is XWHYNMPHCNJWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO/c1-2-8-10(15-16,11(12,13)14)9-6-4-3-5-7-9/h2-7,15-16H,1,8H2.
What are the key properties of N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine?
N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine has a molecular weight of 231.22 g/mol, XLogP of 3.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1,1-trifluoro-2-phenylpent-4-en-2-yl)hydroxylamine is sourced from PubChem (CID 14764219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).