C8F17N — CID 147643073
1,1,1,4,4,5,5,5-octafluoro-N,N,2-tris(trifluoromethyl)pent-2-en-3-amine (PubChem CID 147643073) has the molecular formula C8F17N and a molecular weight of 433.06 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-N,N,2-tris(trifluoromethyl)pent-2-en-3-amine.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-N,N,2-tris(trifluoromethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 147643073 |
| Molecular Formula | C8F17N |
| Molecular Weight | 433.06 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-N,N,2-tris(trifluoromethyl)pent-2-en-3-amine |
| SMILES | FC(F)(F)C(=C(N(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8F17N/c9-3(10,6(17,18)19)2(1(4(11,12)13)5(14,15)16)26(7(20,21)22)8(23,24)25 |
| InChIKey | GHZYKMIZRPXAGD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.06 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|