About 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate
2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate (PubChem CID 147645092) has the molecular formula C22H32O4
and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate |
| PubChem CID | 147645092 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate |
| SMILES | CCC(C(=O)OCCOCCOC1=CC2C=CC=CC2C=C1)C(C)(C)C |
| InChI | InChI=1S/C22H32O4/c1-5-20(22(2,3)4)21(23)26-15-13-24-12-14-25-19-11-10-17-8-6-7-9-18(17)16-19/h6-11,16-18,20H,5,12-15H2,1-4H3 |
| InChIKey | GIJYJLZCAWXXAI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate?
The IUPAC name of 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate (CID 147645092) is 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate.
What is the SMILES notation for 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate?
The canonical SMILES for 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate is CCC(C(=O)OCCOCCOC1=CC2C=CC=CC2C=C1)C(C)(C)C.
What is the InChIKey of 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate?
The InChIKey is GIJYJLZCAWXXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O4/c1-5-20(22(2,3)4)21(23)26-15-13-24-12-14-25-19-11-10-17-8-6-7-9-18(17)16-19/h6-11,16-18,20H,5,12-15H2,1-4H3.
What are the key properties of 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate?
2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate has a molecular weight of 360.49 g/mol, XLogP of 4.45, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4a,8a-dihydronaphthalen-2-yloxy)ethoxy]ethyl 2-ethyl-3,3-dimethylbutanoate is sourced from PubChem (CID 147645092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).