C19H11ClF3N3O — CID 147645240
10-(4-chlorobenzoyl)-6,8,9-trifluoro-1,2,3,4-tetrahydropyrimido[1,2-a]indole-7-carbonitrile (PubChem CID 147645240) has the molecular formula C19H11ClF3N3O and a molecular weight of 389.76 g/mol. Its IUPAC name is 10-(4-chlorobenzoyl)-6,8,9-trifluoro-1,2,3,4-tetrahydropyrimido[1,2-a]indole-7-carbonitrile.
| Compound Name | 10-(4-chlorobenzoyl)-6,8,9-trifluoro-1,2,3,4-tetrahydropyrimido[1,2-a]indole-7-carbonitrile |
|---|---|
| PubChem CID | 147645240 |
| Molecular Formula | C19H11ClF3N3O |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 10-(4-chlorobenzoyl)-6,8,9-trifluoro-1,2,3,4-tetrahydropyrimido[1,2-a]indole-7-carbonitrile |
| SMILES | N#Cc1c(F)c(F)c2c(C(=O)c3ccc(Cl)cc3)c3n(c2c1F)CCCN3 |
| InChI | InChI=1S/C19H11ClF3N3O/c20-10-4-2-9(3-5-10)18(27)13-12-16(23)14(21)11(8-24)15(22)17(12)26-7-1-6-25-19(13)26/h2-5,25H,1,6-7H2 |
| InChIKey | GIKPDNYRKGZQTE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|