About 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene
2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene (PubChem CID 14764787) has the molecular formula C17H17FO4S
and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene |
| PubChem CID | 14764787 |
| Molecular Formula | C17H17FO4S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(/C(C)=C(\F)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H17FO4S/c1-12(15-11-13(21-2)9-10-16(15)22-3)17(18)23(19,20)14-7-5-4-6-8-14/h4-11H,1-3H3/b17-12+ |
| InChIKey | CDAWNGFVBIFSLM-SFQUDFHCSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene?
The IUPAC name of 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene (CID 14764787) is 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene.
What is the SMILES notation for 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene?
The canonical SMILES for 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene is COc1ccc(OC)c(/C(C)=C(\F)S(=O)(=O)c2ccccc2)c1.
What is the InChIKey of 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene?
The InChIKey is CDAWNGFVBIFSLM-SFQUDFHCSA-N. The full InChI is InChI=1S/C17H17FO4S/c1-12(15-11-13(21-2)9-10-16(15)22-3)17(18)23(19,20)14-7-5-4-6-8-14/h4-11H,1-3H3/b17-12+.
What are the key properties of 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene?
2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene has a molecular weight of 336.38 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1-(benzenesulfonyl)-1-fluoroprop-1-en-2-yl]-1,4-dimethoxybenzene is sourced from PubChem (CID 14764787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).