C13H23N3O3SU — CID 147648776
carbanide;3-[3,3-dimethyl-2-(oxomethylamino)butanoyl]-N-methyl-1,3-thiazolidine-4-carboxamide;uranium(2+) (PubChem CID 147648776) has the molecular formula C13H23N3O3SU and a molecular weight of 539.44 g/mol. Its IUPAC name is carbanide;3-[3,3-dimethyl-2-(oxomethylamino)butanoyl]-N-methyl-1,3-thiazolidine-4-carboxamide;uranium(2+).
| Compound Name | carbanide;3-[3,3-dimethyl-2-(oxomethylamino)butanoyl]-N-methyl-1,3-thiazolidine-4-carboxamide;uranium(2+) |
|---|---|
| PubChem CID | 147648776 |
| Molecular Formula | C13H23N3O3SU |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | carbanide;3-[3,3-dimethyl-2-(oxomethylamino)butanoyl]-N-methyl-1,3-thiazolidine-4-carboxamide;uranium(2+) |
| SMILES | CNC(=O)C1CSCN1C(=O)C(N[C-]=O)C(C)(C)C.[CH3-].[U+2] |
| InChI | InChI=1S/C12H20N3O3S.CH3.U/c1-12(2,3)9(14-6-16)11(18)15-7-19-5-8(15)10(17)13-4;;/h8-9H,5,7H2,1-4H3,(H,13,17)(H,14,16);1H3;/q2*-1;+2 |
| InChIKey | VWEKQUXSEHRGEW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|