C19H27N7O6+2 — CID 147649272
[(3aS,4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl] 3,4-dimethylbenzoate (PubChem CID 147649272) has the molecular formula C19H27N7O6+2 and a molecular weight of 449.47 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl] 3,4-dimethylbenzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 147649272 |
| Molecular Formula | C19H27N7O6+2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H]2C[N+]3=C(N)N[C@@H](COC(N)=O)[C@@H]4[NH+]=C(N)N[C@@]43C2(O)O)cc1C |
| InChI | InChI=1S/C19H25N7O6/c1-8-3-4-10(5-9(8)2)14(27)32-12-6-26-16(21)23-11(7-31-17(22)28)13-18(26,19(12,29)30)25-15(20)24-13/h3-5,11-13,29-30H,6-7H2,1-2H3,(H7,20,21,22,23,24,25,28)/p+2/t11-,12-,13-,18-/m0/s1 |
| InChIKey | PPOKBDZNHJIPBX-RSLFNQERSA-P |
| XLogP | -5.02 |
| TPSA | 212.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | -5.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|