C32H58N2O4+2 — CID 147650056
[4-[3-[2-ethyl-4-[3-(2,2,6,6-tetramethyl-1-oxoniopiperidin-4-yl)oxypropyl]phenyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 147650056) has the molecular formula C32H58N2O4+2 and a molecular weight of 534.83 g/mol. Its IUPAC name is [4-[3-[2-ethyl-4-[3-(2,2,6,6-tetramethyl-1-oxoniopiperidin-4-yl)oxypropyl]phenyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-[3-[2-ethyl-4-[3-(2,2,6,6-tetramethyl-1-oxoniopiperidin-4-yl)oxypropyl]phenyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 147650056 |
| Molecular Formula | C32H58N2O4+2 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.44 |
| IUPAC Name | [4-[3-[2-ethyl-4-[3-(2,2,6,6-tetramethyl-1-oxoniopiperidin-4-yl)oxypropyl]phenyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CCc1cc(CCCOC2CC(C)(C)N([OH2+])C(C)(C)C2)ccc1CCCOC1CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C32H56N2O4/c1-10-25-19-24(13-11-17-37-27-20-29(2,3)33(35)30(4,5)21-27)15-16-26(25)14-12-18-38-28-22-31(6,7)34(36)32(8,9)23-28/h15-16,19,27-28,35-36H,10-14,17-18,20-23H2,1-9H3/p+2 |
| InChIKey | GJHXKOKPOHVSKR-UHFFFAOYSA-P |
| XLogP | 5.47 |
| TPSA | 70.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|