C18H36N2O3S2 — CID 147650887
2-[2-(propan-2-ylamino)ethyldisulfanyl]-1-[(2S,4R)-4-propan-2-yloxy-2-(propan-2-yloxymethyl)pyrrolidin-1-yl]ethanone (PubChem CID 147650887) has the molecular formula C18H36N2O3S2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-[2-(propan-2-ylamino)ethyldisulfanyl]-1-[(2S,4R)-4-propan-2-yloxy-2-(propan-2-yloxymethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-[2-(propan-2-ylamino)ethyldisulfanyl]-1-[(2S,4R)-4-propan-2-yloxy-2-(propan-2-yloxymethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 147650887 |
| Molecular Formula | C18H36N2O3S2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[2-(propan-2-ylamino)ethyldisulfanyl]-1-[(2S,4R)-4-propan-2-yloxy-2-(propan-2-yloxymethyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(C)NCCSSCC(=O)N1C[C@H](OC(C)C)C[C@H]1COC(C)C |
| InChI | InChI=1S/C18H36N2O3S2/c1-13(2)19-7-8-24-25-12-18(21)20-10-17(23-15(5)6)9-16(20)11-22-14(3)4/h13-17,19H,7-12H2,1-6H3/t16-,17+/m0/s1 |
| InChIKey | GJLVEFJGQISZFG-DLBZAZTESA-N |
| XLogP | 3.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|