C26H23Cl2FN4O2 — CID 147651895
5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 147651895) has the molecular formula C26H23Cl2FN4O2 and a molecular weight of 513.40 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 147651895 |
| Molecular Formula | C26H23Cl2FN4O2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C26H23Cl2FN4O2/c27-18-6-4-16(21(14-18)26(35)32-24-9-7-19(28)15-31-24)13-23(34)20-8-5-17(12-22(20)29)25(30)33-10-2-1-3-11-33/h4-9,12,14-15,30H,1-3,10-11,13H2,(H,31,32,35)/b30-25- |
| InChIKey | GJQXDUOEJOGKJV-JVCXMKTPSA-N |
| XLogP | 6.02 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|