About ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate
ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate (PubChem CID 147653699) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate |
| PubChem CID | 147653699 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H]2COCC[C@@H]2C)nc1N |
| InChI | InChI=1S/C12H19N3O3/c1-3-18-12(16)9-6-15(14-11(9)13)10-7-17-5-4-8(10)2/h6,8,10H,3-5,7H2,1-2H3,(H2,13,14)/t8-,10-/m0/s1 |
| InChIKey | GJZSEKUMXCNZHL-WPRPVWTQSA-N |
| XLogP | 1.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate?
The IUPAC name of ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate (CID 147653699) is ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate?
The canonical SMILES for ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate is CCOC(=O)c1cn([C@H]2COCC[C@@H]2C)nc1N.
What is the InChIKey of ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate?
The InChIKey is GJZSEKUMXCNZHL-WPRPVWTQSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-3-18-12(16)9-6-15(14-11(9)13)10-7-17-5-4-8(10)2/h6,8,10H,3-5,7H2,1-2H3,(H2,13,14)/t8-,10-/m0/s1.
What are the key properties of ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate?
ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate has a molecular weight of 253.30 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-1-[(3R,4S)-4-methyloxan-3-yl]pyrazole-4-carboxylate is sourced from PubChem (CID 147653699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).