C6H4F4O2 — CID 14765647
2,3,4,5-tetrafluoro-1-methoxycyclopenta-2,4-dien-1-ol (PubChem CID 14765647) has the molecular formula C6H4F4O2 and a molecular weight of 184.09 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-1-methoxycyclopenta-2,4-dien-1-ol.
| Compound Name | 2,3,4,5-tetrafluoro-1-methoxycyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 14765647 |
| Molecular Formula | C6H4F4O2 |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2,3,4,5-tetrafluoro-1-methoxycyclopenta-2,4-dien-1-ol |
| SMILES | COC1(O)C(F)=C(F)C(F)=C1F |
| InChI | InChI=1S/C6H4F4O2/c1-12-6(11)4(9)2(7)3(8)5(6)10/h11H,1H3 |
| InChIKey | YDOSMTZYVNHBCV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|