C9H9F4NOSi — CID 14765653
2,3,4,5-tetrafluoro-1-trimethylsilyloxycyclopenta-2,4-diene-1-carbonitrile (PubChem CID 14765653) has the molecular formula C9H9F4NOSi and a molecular weight of 251.25 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-1-trimethylsilyloxycyclopenta-2,4-diene-1-carbonitrile.
| Compound Name | 2,3,4,5-tetrafluoro-1-trimethylsilyloxycyclopenta-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 14765653 |
| Molecular Formula | C9H9F4NOSi |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-1-trimethylsilyloxycyclopenta-2,4-diene-1-carbonitrile |
| SMILES | C[Si](C)(C)OC1(C#N)C(F)=C(F)C(F)=C1F |
| InChI | InChI=1S/C9H9F4NOSi/c1-16(2,3)15-9(4-14)7(12)5(10)6(11)8(9)13/h1-3H3 |
| InChIKey | JDBBNAUWPFQFBF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|