About 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid
3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid (PubChem CID 147660225) has the molecular formula C17H10ClF2NO4S
and a molecular weight of 397.79 g/mol. Its IUPAC name is 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid |
| PubChem CID | 147660225 |
| Molecular Formula | C17H10ClF2NO4S |
| Molecular Weight | 397.79 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid |
| SMILES | NC(=O)c1cc(F)c(OCc2c(C(=O)O)sc3cccc(Cl)c23)c(F)c1 |
| InChI | InChI=1S/C17H10ClF2NO4S/c18-9-2-1-3-12-13(9)8(15(26-12)17(23)24)6-25-14-10(19)4-7(16(21)22)5-11(14)20/h1-5H,6H2,(H2,21,22)(H,23,24) |
| InChIKey | GLFAZFDFYADMKL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid (CID 147660225) is 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid is NC(=O)c1cc(F)c(OCc2c(C(=O)O)sc3cccc(Cl)c23)c(F)c1.
What is the InChIKey of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid?
The InChIKey is GLFAZFDFYADMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF2NO4S/c18-9-2-1-3-12-13(9)8(15(26-12)17(23)24)6-25-14-10(19)4-7(16(21)22)5-11(14)20/h1-5H,6H2,(H2,21,22)(H,23,24).
What are the key properties of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid?
3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid has a molecular weight of 397.79 g/mol, XLogP of 4.21, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 147660225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).