C17H16N4S2 — CID 1476604
(7S,7aS)-7-methyl-3,7-diphenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione (PubChem CID 1476604) has the molecular formula C17H16N4S2 and a molecular weight of 340.48 g/mol. Its IUPAC name is (7S,7aS)-7-methyl-3,7-diphenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione.
| Compound Name | (7S,7aS)-7-methyl-3,7-diphenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
|---|---|
| PubChem CID | 1476604 |
| Molecular Formula | C17H16N4S2 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (7S,7aS)-7-methyl-3,7-diphenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
| SMILES | C[C@@]1(c2ccccc2)NC(=S)N2[C@@H]1NC(=S)N2c1ccccc1 |
| InChI | InChI=1S/C17H16N4S2/c1-17(12-8-4-2-5-9-12)14-18-15(22)20(21(14)16(23)19-17)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,18,22)(H,19,23)/t14-,17-/m0/s1 |
| InChIKey | OBGAHUXKCOFNDS-YOEHRIQHSA-N |
| XLogP | 2.73 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|