C24H34FNO5S — CID 147666390
3-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfonylpentyl]piperidine-2,6-dione (PubChem CID 147666390) has the molecular formula C24H34FNO5S and a molecular weight of 467.60 g/mol. Its IUPAC name is 3-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfonylpentyl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfonylpentyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147666390 |
| Molecular Formula | C24H34FNO5S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfonylpentyl]piperidine-2,6-dione |
| SMILES | CC(C)(CS(=O)(=O)CCCCCC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H34FNO5S/c1-24(2,19-10-11-20(25)21(14-19)31-15-17-7-8-17)16-32(29,30)13-5-3-4-6-18-9-12-22(27)26-23(18)28/h10-11,14,17-18H,3-9,12-13,15-16H2,1-2H3,(H,26,27,28) |
| InChIKey | GMJRDUHULJTBHK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|