C22H21F3N8O2 — CID 147666772
(9S)-N-[4-(triazol-1-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 147666772) has the molecular formula C22H21F3N8O2 and a molecular weight of 486.46 g/mol. Its IUPAC name is (9S)-N-[4-(triazol-1-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(triazol-1-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 147666772 |
| Molecular Formula | C22H21F3N8O2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (9S)-N-[4-(triazol-1-yl)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C[C@@H](CC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(-n3ccnn3)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N8O2/c1-13(22(23,24)25)10-18(34)16-2-3-17-20(28-16)33(15-5-8-31(17)12-15)21(35)29-19-11-14(4-6-26-19)32-9-7-27-30-32/h2-4,6-7,9,11,13,15H,5,8,10,12H2,1H3,(H,26,29,35)/t13-,15-/m0/s1 |
| InChIKey | GMLMESOPGBQAFF-ZFWWWQNUSA-N |
| XLogP | 3.46 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |