C9H5F13O2 — CID 14766781
1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-prop-2-enoxypropane (PubChem CID 14766781) has the molecular formula C9H5F13O2 and a molecular weight of 392.11 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-prop-2-enoxypropane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-prop-2-enoxypropane |
|---|---|
| PubChem CID | 14766781 |
| Molecular Formula | C9H5F13O2 |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-prop-2-enoxypropane |
| SMILES | C=CCOC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F13O2/c1-2-3-23-9(21,22)5(12,7(16,17)18)24-8(19,20)4(10,11)6(13,14)15/h2H,1,3H2 |
| InChIKey | JGAPXNAZDBXZAQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|