C9H11F3IN — CID 147672009
3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 147672009) has the molecular formula C9H11F3IN and a molecular weight of 317.09 g/mol. Its IUPAC name is 3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 147672009 |
| Molecular Formula | C9H11F3IN |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | FC(F)(F)C1CCC2NC=C(I)C2C1 |
| InChI | InChI=1S/C9H11F3IN/c10-9(11,12)5-1-2-8-6(3-5)7(13)4-14-8/h4-6,8,14H,1-3H2 |
| InChIKey | GNKRAQMGDBJQFD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|