C15H19FN2O7 — CID 147672843
7-fluoro-3-[(3R,5R,6R)-2,3,4,5,6,7-hexahydroxyheptyl]-1H-quinoxalin-2-one (PubChem CID 147672843) has the molecular formula C15H19FN2O7 and a molecular weight of 358.32 g/mol. Its IUPAC name is 7-fluoro-3-[(3R,5R,6R)-2,3,4,5,6,7-hexahydroxyheptyl]-1H-quinoxalin-2-one.
| Compound Name | 7-fluoro-3-[(3R,5R,6R)-2,3,4,5,6,7-hexahydroxyheptyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 147672843 |
| Molecular Formula | C15H19FN2O7 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 7-fluoro-3-[(3R,5R,6R)-2,3,4,5,6,7-hexahydroxyheptyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(F)ccc2nc1CC(O)[C@@H](O)C(O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H19FN2O7/c16-6-1-2-7-8(3-6)18-15(25)9(17-7)4-10(20)12(22)14(24)13(23)11(21)5-19/h1-3,10-14,19-24H,4-5H2,(H,18,25)/t10?,11-,12-,13-,14?/m1/s1 |
| InChIKey | GNOSFNGSDGESKM-DEULPLRUSA-N |
| XLogP | -2.60 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |