C20H25NO2 — CID 147673696
(4aS,7R,8aR)-7-benzyl-4a,9,9-trimethyl-5,6,7,8a-tetrahydro-4H-pyrano[3,2-f][1,2]benzoxazole (PubChem CID 147673696) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (4aS,7R,8aR)-7-benzyl-4a,9,9-trimethyl-5,6,7,8a-tetrahydro-4H-pyrano[3,2-f][1,2]benzoxazole.
| Compound Name | (4aS,7R,8aR)-7-benzyl-4a,9,9-trimethyl-5,6,7,8a-tetrahydro-4H-pyrano[3,2-f][1,2]benzoxazole |
|---|---|
| PubChem CID | 147673696 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (4aS,7R,8aR)-7-benzyl-4a,9,9-trimethyl-5,6,7,8a-tetrahydro-4H-pyrano[3,2-f][1,2]benzoxazole |
| SMILES | CC1(C)c2oncc2C[C@]2(C)CC[C@H](Cc3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C20H25NO2/c1-19(2)17-15(13-21-23-17)12-20(3)10-9-16(22-18(19)20)11-14-7-5-4-6-8-14/h4-8,13,16,18H,9-12H2,1-3H3/t16-,18+,20+/m1/s1 |
| InChIKey | GNSXRSWZHWRFRP-KPFFTGBYSA-N |
| XLogP | 4.30 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |