C16H33NO2 — CID 14767871
(E,2S,3R)-2-aminohexadec-4-ene-1,3-diol (PubChem CID 14767871) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is (E,2S,3R)-2-aminohexadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-aminohexadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 14767871 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | (E,2S,3R)-2-aminohexadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C16H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(19)15(17)14-18/h12-13,15-16,18-19H,2-11,14,17H2,1H3/b13-12+/t15-,16+/m0/s1 |
| InChIKey | BTUSGZZCQZACPT-YYZTVXDQSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|