C25H28FN3O5 — CID 147679942
ethyl 4-[2-(3-fluorobenzoyl)imino-6-(2-hydroxyethoxy)-3H-pyrrolo[3,2-c]pyridin-1-yl]cyclohexane-1-carboxylate (PubChem CID 147679942) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is ethyl 4-[2-(3-fluorobenzoyl)imino-6-(2-hydroxyethoxy)-3H-pyrrolo[3,2-c]pyridin-1-yl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-fluorobenzoyl)imino-6-(2-hydroxyethoxy)-3H-pyrrolo[3,2-c]pyridin-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 147679942 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 4-[2-(3-fluorobenzoyl)imino-6-(2-hydroxyethoxy)-3H-pyrrolo[3,2-c]pyridin-1-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(N2/C(=N/C(=O)c3cccc(F)c3)Cc3cnc(OCCO)cc32)CC1 |
| InChI | InChI=1S/C25H28FN3O5/c1-2-33-25(32)16-6-8-20(9-7-16)29-21-14-23(34-11-10-30)27-15-18(21)13-22(29)28-24(31)17-4-3-5-19(26)12-17/h3-5,12,14-16,20,30H,2,6-11,13H2,1H3/b28-22+ |
| InChIKey | GOXRBIAQPNDLIE-XAYXJRQQSA-N |
| XLogP | 3.32 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|