C18H21BF2O7 — CID 147685818
2,2-dimethylpropanoyloxymethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 147685818) has the molecular formula C18H21BF2O7 and a molecular weight of 398.17 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 147685818 |
| Molecular Formula | C18H21BF2O7 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(=O)C[C@H]1Cc2c(F)c(F)cc(C(=O)OCOC(=O)C(C)(C)C)c2OB1O |
| InChI | InChI=1S/C18H21BF2O7/c1-9(22)5-10-6-11-14(21)13(20)7-12(15(11)28-19(10)25)16(23)26-8-27-17(24)18(2,3)4/h7,10,25H,5-6,8H2,1-4H3/t10-/m0/s1 |
| InChIKey | GPZLRPVZFDYBQD-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|