C15H19NO3 — CID 147690640
2-[(3Z,5E)-5-hydroxyhepta-3,5-dienyl]-5-(methylamino)benzoic acid (PubChem CID 147690640) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-hydroxyhepta-3,5-dienyl]-5-(methylamino)benzoic acid.
| Compound Name | 2-[(3Z,5E)-5-hydroxyhepta-3,5-dienyl]-5-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 147690640 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[(3Z,5E)-5-hydroxyhepta-3,5-dienyl]-5-(methylamino)benzoic acid |
| SMILES | C/C=C(O)\C=C/CCc1ccc(NC)cc1C(=O)O |
| InChI | InChI=1S/C15H19NO3/c1-3-13(17)7-5-4-6-11-8-9-12(16-2)10-14(11)15(18)19/h3,5,7-10,16-17H,4,6H2,1-2H3,(H,18,19)/b7-5-,13-3+ |
| InChIKey | GQXHLZMCSRHONK-WGZXOECTSA-N |
| XLogP | 3.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|